C17H23BO5 — CID 157173975
methyl (3R)-2-hydroxy-3-(2-oxoheptyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 157173975) has the molecular formula C17H23BO5 and a molecular weight of 318.18 g/mol. Its IUPAC name is methyl (3R)-2-hydroxy-3-(2-oxoheptyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | methyl (3R)-2-hydroxy-3-(2-oxoheptyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 157173975 |
| Molecular Formula | C17H23BO5 |
| Molecular Weight | 318.18 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | methyl (3R)-2-hydroxy-3-(2-oxoheptyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CCCCCC(=O)C[C@H]1Cc2cccc(C(=O)OC)c2OB1O |
| InChI | InChI=1S/C17H23BO5/c1-3-4-5-8-14(19)11-13-10-12-7-6-9-15(17(20)22-2)16(12)23-18(13)21/h6-7,9,13,21H,3-5,8,10-11H2,1-2H3/t13-/m1/s1 |
| InChIKey | ZONASKUKYWYRMD-CYBMUJFWSA-N |
| XLogP | 2.80 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.18 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|