C15H17BF2O5 — CID 159171013
(3R)-3-(5,5-difluoro-2-oxohexyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 159171013) has the molecular formula C15H17BF2O5 and a molecular weight of 326.10 g/mol. Its IUPAC name is (3R)-3-(5,5-difluoro-2-oxohexyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-(5,5-difluoro-2-oxohexyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 159171013 |
| Molecular Formula | C15H17BF2O5 |
| Molecular Weight | 326.10 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | (3R)-3-(5,5-difluoro-2-oxohexyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CC(F)(F)CCC(=O)C[C@H]1Cc2cccc(C(=O)O)c2OB1O |
| InChI | InChI=1S/C15H17BF2O5/c1-15(17,18)6-5-11(19)8-10-7-9-3-2-4-12(14(20)21)13(9)23-16(10)22/h2-4,10,22H,5-8H2,1H3,(H,20,21)/t10-/m1/s1 |
| InChIKey | KLRODCUFWSSROF-SNVBAGLBSA-N |
| XLogP | 2.57 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.10 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|