C18H25BO5 — CID 148551959
butyl (3R)-2-hydroxy-3-(2-oxopentyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 148551959) has the molecular formula C18H25BO5 and a molecular weight of 332.21 g/mol. Its IUPAC name is butyl (3R)-2-hydroxy-3-(2-oxopentyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | butyl (3R)-2-hydroxy-3-(2-oxopentyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 148551959 |
| Molecular Formula | C18H25BO5 |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | butyl (3R)-2-hydroxy-3-(2-oxopentyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CCCCOC(=O)c1cccc2c1OB(O)[C@@H](CC(=O)CCC)C2 |
| InChI | InChI=1S/C18H25BO5/c1-3-5-10-23-18(21)16-9-6-8-13-11-14(12-15(20)7-4-2)19(22)24-17(13)16/h6,8-9,14,22H,3-5,7,10-12H2,1-2H3/t14-/m1/s1 |
| InChIKey | MTIDSDHVZBREMN-CQSZACIVSA-N |
| XLogP | 3.19 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|