C20H27BO5 — CID 159529300
ethyl (3R)-3-(3-cyclohexyl-2-oxopropyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 159529300) has the molecular formula C20H27BO5 and a molecular weight of 358.24 g/mol. Its IUPAC name is ethyl (3R)-3-(3-cyclohexyl-2-oxopropyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | ethyl (3R)-3-(3-cyclohexyl-2-oxopropyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 159529300 |
| Molecular Formula | C20H27BO5 |
| Molecular Weight | 358.24 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | ethyl (3R)-3-(3-cyclohexyl-2-oxopropyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CCOC(=O)c1cccc2c1OB(O)[C@@H](CC(=O)CC1CCCCC1)C2 |
| InChI | InChI=1S/C20H27BO5/c1-2-25-20(23)18-10-6-9-15-12-16(21(24)26-19(15)18)13-17(22)11-14-7-4-3-5-8-14/h6,9-10,14,16,24H,2-5,7-8,11-13H2,1H3/t16-/m1/s1 |
| InChIKey | MCUBWEKZJIQCEF-MRXNPFEDSA-N |
| XLogP | 3.58 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.24 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|