C24H34BNO5 — CID 161180233
butyl (3R)-3-[3-(2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl)-2-oxopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 161180233) has the molecular formula C24H34BNO5 and a molecular weight of 427.35 g/mol. Its IUPAC name is butyl (3R)-3-[3-(2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl)-2-oxopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | butyl (3R)-3-[3-(2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl)-2-oxopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 161180233 |
| Molecular Formula | C24H34BNO5 |
| Molecular Weight | 427.35 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | butyl (3R)-3-[3-(2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl)-2-oxopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CCCCOC(=O)c1cccc2c1OB(O)[C@@H](CC(=O)CC1CCC3CNCC3C1)C2 |
| InChI | InChI=1S/C24H34BNO5/c1-2-3-9-30-24(28)22-6-4-5-17-12-20(25(29)31-23(17)22)13-21(27)11-16-7-8-18-14-26-15-19(18)10-16/h4-6,16,18-20,26,29H,2-3,7-15H2,1H3/t16?,18?,19?,20-/m1/s1 |
| InChIKey | CHWQSHRJDOXCIM-WYDVDPGPSA-N |
| XLogP | 3.41 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|