C20H23BN2O5 — CID 131749796
butyl (3R)-2-hydroxy-3-[(2-pyridin-4-ylacetyl)amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 131749796) has the molecular formula C20H23BN2O5 and a molecular weight of 382.23 g/mol. Its IUPAC name is butyl (3R)-2-hydroxy-3-[(2-pyridin-4-ylacetyl)amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | butyl (3R)-2-hydroxy-3-[(2-pyridin-4-ylacetyl)amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 131749796 |
| Molecular Formula | C20H23BN2O5 |
| Molecular Weight | 382.23 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | butyl (3R)-2-hydroxy-3-[(2-pyridin-4-ylacetyl)amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CCCCOC(=O)c1cccc2c1OB(O)[C@@H](NC(=O)Cc1ccncc1)C2 |
| InChI | InChI=1S/C20H23BN2O5/c1-2-3-11-27-20(25)16-6-4-5-15-13-17(21(26)28-19(15)16)23-18(24)12-14-7-9-22-10-8-14/h4-10,17,26H,2-3,11-13H2,1H3,(H,23,24)/t17-/m0/s1 |
| InChIKey | QSSXMARRWUCFFZ-KRWDZBQOSA-N |
| XLogP | 1.72 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.23 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|