C15H17BN2O5 — CID 140739700
ethyl (3R)-3-(3-cyanopropanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 140739700) has the molecular formula C15H17BN2O5 and a molecular weight of 316.12 g/mol. Its IUPAC name is ethyl (3R)-3-(3-cyanopropanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | ethyl (3R)-3-(3-cyanopropanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 140739700 |
| Molecular Formula | C15H17BN2O5 |
| Molecular Weight | 316.12 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | ethyl (3R)-3-(3-cyanopropanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CCOC(=O)c1cccc2c1OB(O)[C@@H](NC(=O)CCC#N)C2 |
| InChI | InChI=1S/C15H17BN2O5/c1-2-22-15(20)11-6-3-5-10-9-12(16(21)23-14(10)11)18-13(19)7-4-8-17/h3,5-6,12,21H,2,4,7,9H2,1H3,(H,18,19)/t12-/m0/s1 |
| InChIKey | JCMBXVWNQYIPTG-LBPRGKRZSA-N |
| XLogP | 0.61 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.12 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|