C20H25BF3NO7 — CID 145329230
pentanoyloxymethyl (3R)-2-hydroxy-3-(5,5,5-trifluoropentanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 145329230) has the molecular formula C20H25BF3NO7 and a molecular weight of 459.23 g/mol. Its IUPAC name is pentanoyloxymethyl (3R)-2-hydroxy-3-(5,5,5-trifluoropentanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | pentanoyloxymethyl (3R)-2-hydroxy-3-(5,5,5-trifluoropentanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 145329230 |
| Molecular Formula | C20H25BF3NO7 |
| Molecular Weight | 459.23 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | pentanoyloxymethyl (3R)-2-hydroxy-3-(5,5,5-trifluoropentanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CCCCC(=O)OCOC(=O)c1cccc2c1OB(O)[C@@H](NC(=O)CCCC(F)(F)F)C2 |
| InChI | InChI=1S/C20H25BF3NO7/c1-2-3-9-17(27)30-12-31-19(28)14-7-4-6-13-11-15(21(29)32-18(13)14)25-16(26)8-5-10-20(22,23)24/h4,6-7,15,29H,2-3,5,8-12H2,1H3,(H,25,26)/t15-/m0/s1 |
| InChIKey | DCLLHBMMVQZKKK-HNNXBMFYSA-N |
| XLogP | 2.71 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.23 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|