C19H22BF3N2O8 — CID 145329216
[4-(dimethylamino)-4-oxobutanoyl]oxymethyl (3R)-2-hydroxy-3-(3,3,3-trifluoropropanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 145329216) has the molecular formula C19H22BF3N2O8 and a molecular weight of 474.20 g/mol. Its IUPAC name is [4-(dimethylamino)-4-oxobutanoyl]oxymethyl (3R)-2-hydroxy-3-(3,3,3-trifluoropropanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | [4-(dimethylamino)-4-oxobutanoyl]oxymethyl (3R)-2-hydroxy-3-(3,3,3-trifluoropropanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 145329216 |
| Molecular Formula | C19H22BF3N2O8 |
| Molecular Weight | 474.20 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | [4-(dimethylamino)-4-oxobutanoyl]oxymethyl (3R)-2-hydroxy-3-(3,3,3-trifluoropropanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CN(C)C(=O)CCC(=O)OCOC(=O)c1cccc2c1OB(O)[C@@H](NC(=O)CC(F)(F)F)C2 |
| InChI | InChI=1S/C19H22BF3N2O8/c1-25(2)15(27)6-7-16(28)31-10-32-18(29)12-5-3-4-11-8-13(20(30)33-17(11)12)24-14(26)9-19(21,22)23/h3-5,13,30H,6-10H2,1-2H3,(H,24,26)/t13-/m0/s1 |
| InChIKey | ZTOKKLYCRUNNHY-ZDUSSCGKSA-N |
| XLogP | 0.60 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.20 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|