C22H27BF3NO8 — CID 145329158
[2-(oxan-4-yl)acetyl]oxymethyl (3R)-2-hydroxy-3-(5,5,5-trifluoropentanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 145329158) has the molecular formula C22H27BF3NO8 and a molecular weight of 501.26 g/mol. Its IUPAC name is [2-(oxan-4-yl)acetyl]oxymethyl (3R)-2-hydroxy-3-(5,5,5-trifluoropentanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | [2-(oxan-4-yl)acetyl]oxymethyl (3R)-2-hydroxy-3-(5,5,5-trifluoropentanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 145329158 |
| Molecular Formula | C22H27BF3NO8 |
| Molecular Weight | 501.26 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | [2-(oxan-4-yl)acetyl]oxymethyl (3R)-2-hydroxy-3-(5,5,5-trifluoropentanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | O=C(CCCC(F)(F)F)N[C@H]1Cc2cccc(C(=O)OCOC(=O)CC3CCOCC3)c2OB1O |
| InChI | InChI=1S/C22H27BF3NO8/c24-22(25,26)8-2-5-18(28)27-17-12-15-3-1-4-16(20(15)35-23(17)31)21(30)34-13-33-19(29)11-14-6-9-32-10-7-14/h1,3-4,14,17,31H,2,5-13H2,(H,27,28)/t17-/m0/s1 |
| InChIKey | LWZMKQZJGQESHG-KRWDZBQOSA-N |
| XLogP | 2.33 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|