C19H25BF3NO5 — CID 145329304
3-methylbutyl (3R)-2-hydroxy-3-(5,5,5-trifluoropentanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 145329304) has the molecular formula C19H25BF3NO5 and a molecular weight of 415.22 g/mol. Its IUPAC name is 3-methylbutyl (3R)-2-hydroxy-3-(5,5,5-trifluoropentanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | 3-methylbutyl (3R)-2-hydroxy-3-(5,5,5-trifluoropentanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 145329304 |
| Molecular Formula | C19H25BF3NO5 |
| Molecular Weight | 415.22 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 3-methylbutyl (3R)-2-hydroxy-3-(5,5,5-trifluoropentanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CC(C)CCOC(=O)c1cccc2c1OB(O)[C@@H](NC(=O)CCCC(F)(F)F)C2 |
| InChI | InChI=1S/C19H25BF3NO5/c1-12(2)8-10-28-18(26)14-6-3-5-13-11-15(20(27)29-17(13)14)24-16(25)7-4-9-19(21,22)23/h3,5-6,12,15,27H,4,7-11H2,1-2H3,(H,24,25)/t15-/m0/s1 |
| InChIKey | ORADLLTUHRHXMM-HNNXBMFYSA-N |
| XLogP | 3.06 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.22 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|