C22H30BF2NO7 — CID 145329080
[2-methyl-1-(2-methylpropanoyloxy)propyl] (3R)-3-(4,4-difluoropentanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 145329080) has the molecular formula C22H30BF2NO7 and a molecular weight of 469.29 g/mol. Its IUPAC name is [2-methyl-1-(2-methylpropanoyloxy)propyl] (3R)-3-(4,4-difluoropentanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | [2-methyl-1-(2-methylpropanoyloxy)propyl] (3R)-3-(4,4-difluoropentanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 145329080 |
| Molecular Formula | C22H30BF2NO7 |
| Molecular Weight | 469.29 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | [2-methyl-1-(2-methylpropanoyloxy)propyl] (3R)-3-(4,4-difluoropentanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CC(C)C(=O)OC(OC(=O)c1cccc2c1OB(O)[C@@H](NC(=O)CCC(C)(F)F)C2)C(C)C |
| InChI | InChI=1S/C22H30BF2NO7/c1-12(2)19(28)31-21(13(3)4)32-20(29)15-8-6-7-14-11-16(23(30)33-18(14)15)26-17(27)9-10-22(5,24)25/h6-8,12-13,16,21,30H,9-11H2,1-5H3,(H,26,27)/t16-,21?/m0/s1 |
| InChIKey | DEIZZWNWSLKYGU-BJQOMGFOSA-N |
| XLogP | 2.90 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|