C20H26BF2NO8 — CID 145329324
1-propan-2-yloxycarbonyloxyethyl (3R)-3-(4,4-difluoropentanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 145329324) has the molecular formula C20H26BF2NO8 and a molecular weight of 457.24 g/mol. Its IUPAC name is 1-propan-2-yloxycarbonyloxyethyl (3R)-3-(4,4-difluoropentanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | 1-propan-2-yloxycarbonyloxyethyl (3R)-3-(4,4-difluoropentanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 145329324 |
| Molecular Formula | C20H26BF2NO8 |
| Molecular Weight | 457.24 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 1-propan-2-yloxycarbonyloxyethyl (3R)-3-(4,4-difluoropentanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CC(C)OC(=O)OC(C)OC(=O)c1cccc2c1OB(O)[C@@H](NC(=O)CCC(C)(F)F)C2 |
| InChI | InChI=1S/C20H26BF2NO8/c1-11(2)29-19(27)31-12(3)30-18(26)14-7-5-6-13-10-15(21(28)32-17(13)14)24-16(25)8-9-20(4,22)23/h5-7,11-12,15,28H,8-10H2,1-4H3,(H,24,25)/t12?,15-/m0/s1 |
| InChIKey | KZAVHXJLQLQAPZ-CVRLYYSRSA-N |
| XLogP | 2.63 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.24 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|