C19H23BF3NO8 — CID 140925467
1-propan-2-yloxycarbonyloxyethyl 2-hydroxy-3-(4,4,4-trifluorobutanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 140925467) has the molecular formula C19H23BF3NO8 and a molecular weight of 461.20 g/mol. Its IUPAC name is 1-propan-2-yloxycarbonyloxyethyl 2-hydroxy-3-(4,4,4-trifluorobutanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | 1-propan-2-yloxycarbonyloxyethyl 2-hydroxy-3-(4,4,4-trifluorobutanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 140925467 |
| Molecular Formula | C19H23BF3NO8 |
| Molecular Weight | 461.20 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 1-propan-2-yloxycarbonyloxyethyl 2-hydroxy-3-(4,4,4-trifluorobutanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CC(C)OC(=O)OC(C)OC(=O)c1cccc2c1OB(O)C(NC(=O)CCC(F)(F)F)C2 |
| InChI | InChI=1S/C19H23BF3NO8/c1-10(2)29-18(27)31-11(3)30-17(26)13-6-4-5-12-9-14(20(28)32-16(12)13)24-15(25)7-8-19(21,22)23/h4-6,10-11,14,28H,7-9H2,1-3H3,(H,24,25) |
| InChIKey | LPKJYFPBRJOSSH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.20 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|