C19H21BF3NO8 — CID 145329270
(2,2,4-trimethyl-5-oxo-1,3-dioxolan-4-yl) (3R)-2-hydroxy-3-(4,4,4-trifluorobutanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 145329270) has the molecular formula C19H21BF3NO8 and a molecular weight of 459.18 g/mol. Its IUPAC name is (2,2,4-trimethyl-5-oxo-1,3-dioxolan-4-yl) (3R)-2-hydroxy-3-(4,4,4-trifluorobutanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | (2,2,4-trimethyl-5-oxo-1,3-dioxolan-4-yl) (3R)-2-hydroxy-3-(4,4,4-trifluorobutanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 145329270 |
| Molecular Formula | C19H21BF3NO8 |
| Molecular Weight | 459.18 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | (2,2,4-trimethyl-5-oxo-1,3-dioxolan-4-yl) (3R)-2-hydroxy-3-(4,4,4-trifluorobutanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CC1(C)OC(=O)C(C)(OC(=O)c2cccc3c2OB(O)[C@@H](NC(=O)CCC(F)(F)F)C3)O1 |
| InChI | InChI=1S/C19H21BF3NO8/c1-17(2)30-16(27)18(3,32-17)29-15(26)11-6-4-5-10-9-12(20(28)31-14(10)11)24-13(25)7-8-19(21,22)23/h4-6,12,28H,7-9H2,1-3H3,(H,24,25)/t12-,18?/m0/s1 |
| InChIKey | PWVLXKGKQMJHOT-RSXQAXDFSA-N |
| XLogP | 1.65 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.18 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|