C14H15BF3NO5 — CID 145329265
ethyl (3R)-2-hydroxy-3-(3,3,3-trifluoropropanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 145329265) has the molecular formula C14H15BF3NO5 and a molecular weight of 345.08 g/mol. Its IUPAC name is ethyl (3R)-2-hydroxy-3-(3,3,3-trifluoropropanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | ethyl (3R)-2-hydroxy-3-(3,3,3-trifluoropropanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 145329265 |
| Molecular Formula | C14H15BF3NO5 |
| Molecular Weight | 345.08 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | ethyl (3R)-2-hydroxy-3-(3,3,3-trifluoropropanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CCOC(=O)c1cccc2c1OB(O)[C@@H](NC(=O)CC(F)(F)F)C2 |
| InChI | InChI=1S/C14H15BF3NO5/c1-2-23-13(21)9-5-3-4-8-6-10(15(22)24-12(8)9)19-11(20)7-14(16,17)18/h3-5,10,22H,2,6-7H2,1H3,(H,19,20)/t10-/m0/s1 |
| InChIKey | WQXRUJMYMOVYDY-JTQLQIEISA-N |
| XLogP | 1.26 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.08 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|