C22H20BNO5 — CID 163477697
ethyl (3R)-2-hydroxy-3-(naphthalene-1-carbonylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 163477697) has the molecular formula C22H20BNO5 and a molecular weight of 389.22 g/mol. Its IUPAC name is ethyl (3R)-2-hydroxy-3-(naphthalene-1-carbonylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | ethyl (3R)-2-hydroxy-3-(naphthalene-1-carbonylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 163477697 |
| Molecular Formula | C22H20BNO5 |
| Molecular Weight | 389.22 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | ethyl (3R)-2-hydroxy-3-(naphthalene-1-carbonylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CCOC(=O)c1cccc2c1OB(O)[C@@H](NC(=O)c1cccc3ccccc13)C2 |
| InChI | InChI=1S/C22H20BNO5/c1-2-28-22(26)18-12-6-9-15-13-19(23(27)29-20(15)18)24-21(25)17-11-5-8-14-7-3-4-10-16(14)17/h3-12,19,27H,2,13H2,1H3,(H,24,25)/t19-/m0/s1 |
| InChIKey | CBWBWERNDGEGFJ-IBGZPJMESA-N |
| XLogP | 2.77 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.22 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|