C18H26BNO5 — CID 140925487
4-methylpentyl (3R)-2-hydroxy-3-(propanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 140925487) has the molecular formula C18H26BNO5 and a molecular weight of 347.22 g/mol. Its IUPAC name is 4-methylpentyl (3R)-2-hydroxy-3-(propanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | 4-methylpentyl (3R)-2-hydroxy-3-(propanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 140925487 |
| Molecular Formula | C18H26BNO5 |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 4-methylpentyl (3R)-2-hydroxy-3-(propanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CCC(=O)N[C@H]1Cc2cccc(C(=O)OCCCC(C)C)c2OB1O |
| InChI | InChI=1S/C18H26BNO5/c1-4-16(21)20-15-11-13-8-5-9-14(17(13)25-19(15)23)18(22)24-10-6-7-12(2)3/h5,8-9,12,15,23H,4,6-7,10-11H2,1-3H3,(H,20,21)/t15-/m0/s1 |
| InChIKey | RFCIIBSRGGOIIR-HNNXBMFYSA-N |
| XLogP | 2.13 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|