C19H24BNO8 — CID 140925490
cyclopentyloxycarbonyloxymethyl (3R)-2-hydroxy-3-(propanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 140925490) has the molecular formula C19H24BNO8 and a molecular weight of 405.21 g/mol. Its IUPAC name is cyclopentyloxycarbonyloxymethyl (3R)-2-hydroxy-3-(propanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | cyclopentyloxycarbonyloxymethyl (3R)-2-hydroxy-3-(propanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 140925490 |
| Molecular Formula | C19H24BNO8 |
| Molecular Weight | 405.21 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | cyclopentyloxycarbonyloxymethyl (3R)-2-hydroxy-3-(propanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CCC(=O)N[C@H]1Cc2cccc(C(=O)OCOC(=O)OC3CCCC3)c2OB1O |
| InChI | InChI=1S/C19H24BNO8/c1-2-16(22)21-15-10-12-6-5-9-14(17(12)29-20(15)25)18(23)26-11-27-19(24)28-13-7-3-4-8-13/h5-6,9,13,15,25H,2-4,7-8,10-11H2,1H3,(H,21,22)/t15-/m0/s1 |
| InChIKey | PHWNQYWRPAZCGU-HNNXBMFYSA-N |
| XLogP | 1.75 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.21 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|