C22H28BF2NO8 — CID 145329126
1-cyclohexyloxycarbonyloxyethyl (3R)-3-(3,3-difluorobutanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 145329126) has the molecular formula C22H28BF2NO8 and a molecular weight of 483.27 g/mol. Its IUPAC name is 1-cyclohexyloxycarbonyloxyethyl (3R)-3-(3,3-difluorobutanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | 1-cyclohexyloxycarbonyloxyethyl (3R)-3-(3,3-difluorobutanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 145329126 |
| Molecular Formula | C22H28BF2NO8 |
| Molecular Weight | 483.27 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | 1-cyclohexyloxycarbonyloxyethyl (3R)-3-(3,3-difluorobutanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CC(OC(=O)OC1CCCCC1)OC(=O)c1cccc2c1OB(O)[C@@H](NC(=O)CC(C)(F)F)C2 |
| InChI | InChI=1S/C22H28BF2NO8/c1-13(32-21(29)33-15-8-4-3-5-9-15)31-20(28)16-10-6-7-14-11-17(23(30)34-19(14)16)26-18(27)12-22(2,24)25/h6-7,10,13,15,17,30H,3-5,8-9,11-12H2,1-2H3,(H,26,27)/t13?,17-/m0/s1 |
| InChIKey | FJPUJFGAQAZJJS-RUINGEJQSA-N |
| XLogP | 3.16 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.27 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|