C23H29BF2O8 — CID 159670957
1-cyclohexyloxycarbonyloxyethyl (3R)-3-(3,3-difluoro-2-oxopentyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 159670957) has the molecular formula C23H29BF2O8 and a molecular weight of 482.29 g/mol. Its IUPAC name is 1-cyclohexyloxycarbonyloxyethyl (3R)-3-(3,3-difluoro-2-oxopentyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | 1-cyclohexyloxycarbonyloxyethyl (3R)-3-(3,3-difluoro-2-oxopentyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 159670957 |
| Molecular Formula | C23H29BF2O8 |
| Molecular Weight | 482.29 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | 1-cyclohexyloxycarbonyloxyethyl (3R)-3-(3,3-difluoro-2-oxopentyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CCC(F)(F)C(=O)C[C@H]1Cc2cccc(C(=O)OC(C)OC(=O)OC3CCCCC3)c2OB1O |
| InChI | InChI=1S/C23H29BF2O8/c1-3-23(25,26)19(27)13-16-12-15-8-7-11-18(20(15)34-24(16)30)21(28)31-14(2)32-22(29)33-17-9-5-4-6-10-17/h7-8,11,14,16-17,30H,3-6,9-10,12-13H2,1-2H3/t14?,16-/m1/s1 |
| InChIKey | XGPHWESHFMZDDO-BZSJEYESSA-N |
| XLogP | 4.47 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.29 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|