C21H21BF2O5 — CID 157394291
benzyl (3R)-3-(3,3-difluoro-2-oxopentyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 157394291) has the molecular formula C21H21BF2O5 and a molecular weight of 402.20 g/mol. Its IUPAC name is benzyl (3R)-3-(3,3-difluoro-2-oxopentyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | benzyl (3R)-3-(3,3-difluoro-2-oxopentyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 157394291 |
| Molecular Formula | C21H21BF2O5 |
| Molecular Weight | 402.20 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | benzyl (3R)-3-(3,3-difluoro-2-oxopentyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CCC(F)(F)C(=O)C[C@H]1Cc2cccc(C(=O)OCc3ccccc3)c2OB1O |
| InChI | InChI=1S/C21H21BF2O5/c1-2-21(23,24)18(25)12-16-11-15-9-6-10-17(19(15)29-22(16)27)20(26)28-13-14-7-4-3-5-8-14/h3-10,16,27H,2,11-13H2,1H3/t16-/m1/s1 |
| InChIKey | BMJQHBSCRRNEGS-MRXNPFEDSA-N |
| XLogP | 3.83 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.20 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|