C21H25BF2O8 — CID 161436553
oxane-4-carbonyloxymethyl (3R)-3-(3,3-difluoro-2-oxopentyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 161436553) has the molecular formula C21H25BF2O8 and a molecular weight of 454.23 g/mol. Its IUPAC name is oxane-4-carbonyloxymethyl (3R)-3-(3,3-difluoro-2-oxopentyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | oxane-4-carbonyloxymethyl (3R)-3-(3,3-difluoro-2-oxopentyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 161436553 |
| Molecular Formula | C21H25BF2O8 |
| Molecular Weight | 454.23 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | oxane-4-carbonyloxymethyl (3R)-3-(3,3-difluoro-2-oxopentyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CCC(F)(F)C(=O)C[C@H]1Cc2cccc(C(=O)OCOC(=O)C3CCOCC3)c2OB1O |
| InChI | InChI=1S/C21H25BF2O8/c1-2-21(23,24)17(25)11-15-10-14-4-3-5-16(18(14)32-22(15)28)20(27)31-12-30-19(26)13-6-8-29-9-7-13/h3-5,13,15,28H,2,6-12H2,1H3/t15-/m1/s1 |
| InChIKey | ZQBVCNDCJYULRS-OAHLLOKOSA-N |
| XLogP | 2.56 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.23 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|