C24H27BO8 — CID 159588870
2,2-dimethylpropanoyloxymethyl (3R)-2-hydroxy-3-[2-(3-methoxyphenyl)-2-oxoethyl]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 159588870) has the molecular formula C24H27BO8 and a molecular weight of 454.28 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl (3R)-2-hydroxy-3-[2-(3-methoxyphenyl)-2-oxoethyl]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl (3R)-2-hydroxy-3-[2-(3-methoxyphenyl)-2-oxoethyl]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 159588870 |
| Molecular Formula | C24H27BO8 |
| Molecular Weight | 454.28 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl (3R)-2-hydroxy-3-[2-(3-methoxyphenyl)-2-oxoethyl]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | COc1cccc(C(=O)C[C@H]2Cc3cccc(C(=O)OCOC(=O)C(C)(C)C)c3OB2O)c1 |
| InChI | InChI=1S/C24H27BO8/c1-24(2,3)23(28)32-14-31-22(27)19-10-6-8-16-11-17(25(29)33-21(16)19)13-20(26)15-7-5-9-18(12-15)30-4/h5-10,12,17,29H,11,13-14H2,1-4H3/t17-/m1/s1 |
| InChIKey | MJZBSMRROMLAMQ-QGZVFWFLSA-N |
| XLogP | 3.46 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.28 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|