C18H23BO7 — CID 158865552
butanoyloxymethyl (3R)-2-hydroxy-3-(2-oxobutyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 158865552) has the molecular formula C18H23BO7 and a molecular weight of 362.19 g/mol. Its IUPAC name is butanoyloxymethyl (3R)-2-hydroxy-3-(2-oxobutyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | butanoyloxymethyl (3R)-2-hydroxy-3-(2-oxobutyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 158865552 |
| Molecular Formula | C18H23BO7 |
| Molecular Weight | 362.19 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | butanoyloxymethyl (3R)-2-hydroxy-3-(2-oxobutyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CCCC(=O)OCOC(=O)c1cccc2c1OB(O)[C@@H](CC(=O)CC)C2 |
| InChI | InChI=1S/C18H23BO7/c1-3-6-16(21)24-11-25-18(22)15-8-5-7-12-9-13(10-14(20)4-2)19(23)26-17(12)15/h5,7-8,13,23H,3-4,6,9-11H2,1-2H3/t13-/m1/s1 |
| InChIKey | XXIGNPSBQHOQOE-CYBMUJFWSA-N |
| XLogP | 2.30 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.19 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|