C19H23BO5 — CID 158011519
butyl (3R)-2-hydroxy-3-(2-oxohex-5-ynyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 158011519) has the molecular formula C19H23BO5 and a molecular weight of 342.20 g/mol. Its IUPAC name is butyl (3R)-2-hydroxy-3-(2-oxohex-5-ynyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | butyl (3R)-2-hydroxy-3-(2-oxohex-5-ynyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 158011519 |
| Molecular Formula | C19H23BO5 |
| Molecular Weight | 342.20 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | butyl (3R)-2-hydroxy-3-(2-oxohex-5-ynyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | C#CCCC(=O)C[C@H]1Cc2cccc(C(=O)OCCCC)c2OB1O |
| InChI | InChI=1S/C19H23BO5/c1-3-5-9-16(21)13-15-12-14-8-7-10-17(18(14)25-20(15)23)19(22)24-11-6-4-2/h1,7-8,10,15,23H,4-6,9,11-13H2,2H3/t15-/m1/s1 |
| InChIKey | QEINYEWBJXEBBL-OAHLLOKOSA-N |
| XLogP | 2.80 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.20 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|