C18H20BNO6 — CID 148862138
butyl (3R)-2-hydroxy-3-[2-(1,2-oxazol-5-yl)-2-oxoethyl]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 148862138) has the molecular formula C18H20BNO6 and a molecular weight of 357.17 g/mol. Its IUPAC name is butyl (3R)-2-hydroxy-3-[2-(1,2-oxazol-5-yl)-2-oxoethyl]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | butyl (3R)-2-hydroxy-3-[2-(1,2-oxazol-5-yl)-2-oxoethyl]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 148862138 |
| Molecular Formula | C18H20BNO6 |
| Molecular Weight | 357.17 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | butyl (3R)-2-hydroxy-3-[2-(1,2-oxazol-5-yl)-2-oxoethyl]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CCCCOC(=O)c1cccc2c1OB(O)[C@@H](CC(=O)c1ccno1)C2 |
| InChI | InChI=1S/C18H20BNO6/c1-2-3-9-24-18(22)14-6-4-5-12-10-13(19(23)25-17(12)14)11-15(21)16-7-8-20-26-16/h4-8,13,23H,2-3,9-11H2,1H3/t13-/m1/s1 |
| InChIKey | OZNRHFCAZSETKI-CYBMUJFWSA-N |
| XLogP | 2.69 |
| TPSA | 98.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.17 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|