C15H17BO7 — CID 147898063
acetyloxymethyl (3R)-2-hydroxy-3-(2-oxopropyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 147898063) has the molecular formula C15H17BO7 and a molecular weight of 320.11 g/mol. Its IUPAC name is acetyloxymethyl (3R)-2-hydroxy-3-(2-oxopropyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | acetyloxymethyl (3R)-2-hydroxy-3-(2-oxopropyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 147898063 |
| Molecular Formula | C15H17BO7 |
| Molecular Weight | 320.11 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | acetyloxymethyl (3R)-2-hydroxy-3-(2-oxopropyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CC(=O)C[C@H]1Cc2cccc(C(=O)OCOC(C)=O)c2OB1O |
| InChI | InChI=1S/C15H17BO7/c1-9(17)6-12-7-11-4-3-5-13(14(11)23-16(12)20)15(19)22-8-21-10(2)18/h3-5,12,20H,6-8H2,1-2H3/t12-/m0/s1 |
| InChIKey | IDRXUISEMGPMOX-LBPRGKRZSA-N |
| XLogP | 1.13 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.11 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|