C23H21BO7 — CID 157155038
benzoyloxymethyl (3R)-2-hydroxy-3-(2-oxohex-5-ynyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 157155038) has the molecular formula C23H21BO7 and a molecular weight of 420.23 g/mol. Its IUPAC name is benzoyloxymethyl (3R)-2-hydroxy-3-(2-oxohex-5-ynyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | benzoyloxymethyl (3R)-2-hydroxy-3-(2-oxohex-5-ynyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 157155038 |
| Molecular Formula | C23H21BO7 |
| Molecular Weight | 420.23 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | benzoyloxymethyl (3R)-2-hydroxy-3-(2-oxohex-5-ynyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | C#CCCC(=O)C[C@H]1Cc2cccc(C(=O)OCOC(=O)c3ccccc3)c2OB1O |
| InChI | InChI=1S/C23H21BO7/c1-2-3-11-19(25)14-18-13-17-10-7-12-20(21(17)31-24(18)28)23(27)30-15-29-22(26)16-8-5-4-6-9-16/h1,4-10,12,18,28H,3,11,13-15H2/t18-/m1/s1 |
| InChIKey | ALSAQBMSXFVZSS-GOSISDBHSA-N |
| XLogP | 2.82 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.23 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|