C21H25BO8 — CID 148629160
1-propan-2-yloxycarbonyloxyethyl (3R)-2-hydroxy-3-(2-oxohex-5-ynyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 148629160) has the molecular formula C21H25BO8 and a molecular weight of 416.24 g/mol. Its IUPAC name is 1-propan-2-yloxycarbonyloxyethyl (3R)-2-hydroxy-3-(2-oxohex-5-ynyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | 1-propan-2-yloxycarbonyloxyethyl (3R)-2-hydroxy-3-(2-oxohex-5-ynyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 148629160 |
| Molecular Formula | C21H25BO8 |
| Molecular Weight | 416.24 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 1-propan-2-yloxycarbonyloxyethyl (3R)-2-hydroxy-3-(2-oxohex-5-ynyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | C#CCCC(=O)C[C@H]1Cc2cccc(C(=O)OC(C)OC(=O)OC(C)C)c2OB1O |
| InChI | InChI=1S/C21H25BO8/c1-5-6-9-17(23)12-16-11-15-8-7-10-18(19(15)30-22(16)26)20(24)28-14(4)29-21(25)27-13(2)3/h1,7-8,10,13-14,16,26H,6,9,11-12H2,2-4H3/t14?,16-/m1/s1 |
| InChIKey | NHURHOZZDYFQSC-BZSJEYESSA-N |
| XLogP | 2.91 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.24 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|