C16H22BNO7S — CID 153250635
ethyl (3R)-2-hydroxy-3-(2-oxo-5-sulfamoylpentyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 153250635) has the molecular formula C16H22BNO7S and a molecular weight of 383.23 g/mol. Its IUPAC name is ethyl (3R)-2-hydroxy-3-(2-oxo-5-sulfamoylpentyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | ethyl (3R)-2-hydroxy-3-(2-oxo-5-sulfamoylpentyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 153250635 |
| Molecular Formula | C16H22BNO7S |
| Molecular Weight | 383.23 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | ethyl (3R)-2-hydroxy-3-(2-oxo-5-sulfamoylpentyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CCOC(=O)c1cccc2c1OB(O)[C@@H](CC(=O)CCCS(N)(=O)=O)C2 |
| InChI | InChI=1S/C16H22BNO7S/c1-2-24-16(20)14-7-3-5-11-9-12(17(21)25-15(11)14)10-13(19)6-4-8-26(18,22)23/h3,5,7,12,21H,2,4,6,8-10H2,1H3,(H2,18,22,23)/t12-/m1/s1 |
| InChIKey | WTGGNCDGAMIQBS-GFCCVEGCSA-N |
| XLogP | 0.68 |
| TPSA | 132.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.23 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|