C22H20BNO7 — CID 160961629
(1,3-dioxoisoindol-2-yl)methyl (3R)-2-hydroxy-3-(2-oxobutyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 160961629) has the molecular formula C22H20BNO7 and a molecular weight of 421.21 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl (3R)-2-hydroxy-3-(2-oxobutyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl (3R)-2-hydroxy-3-(2-oxobutyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 160961629 |
| Molecular Formula | C22H20BNO7 |
| Molecular Weight | 421.21 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl (3R)-2-hydroxy-3-(2-oxobutyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CCC(=O)C[C@H]1Cc2cccc(C(=O)OCN3C(=O)c4ccccc4C3=O)c2OB1O |
| InChI | InChI=1S/C22H20BNO7/c1-2-15(25)11-14-10-13-6-5-9-18(19(13)31-23(14)29)22(28)30-12-24-20(26)16-7-3-4-8-17(16)21(24)27/h3-9,14,29H,2,10-12H2,1H3/t14-/m1/s1 |
| InChIKey | WZHVFKPHHPTKHZ-CQSZACIVSA-N |
| XLogP | 2.25 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.21 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|