C20H27BO7S — CID 157433853
(2-ethylsulfanyl-2-methylpropanoyl)oxymethyl (3R)-2-hydroxy-3-(2-oxobutyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 157433853) has the molecular formula C20H27BO7S and a molecular weight of 422.31 g/mol. Its IUPAC name is (2-ethylsulfanyl-2-methylpropanoyl)oxymethyl (3R)-2-hydroxy-3-(2-oxobutyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | (2-ethylsulfanyl-2-methylpropanoyl)oxymethyl (3R)-2-hydroxy-3-(2-oxobutyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 157433853 |
| Molecular Formula | C20H27BO7S |
| Molecular Weight | 422.31 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | (2-ethylsulfanyl-2-methylpropanoyl)oxymethyl (3R)-2-hydroxy-3-(2-oxobutyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CCSC(C)(C)C(=O)OCOC(=O)c1cccc2c1OB(O)[C@@H](CC(=O)CC)C2 |
| InChI | InChI=1S/C20H27BO7S/c1-5-15(22)11-14-10-13-8-7-9-16(17(13)28-21(14)25)18(23)26-12-27-19(24)20(3,4)29-6-2/h7-9,14,25H,5-6,10-12H2,1-4H3/t14-/m1/s1 |
| InChIKey | QLPNAKONSXUQPR-CQSZACIVSA-N |
| XLogP | 3.03 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|