C19H25BO8 — CID 158495132
2,2-dimethylpropanoyloxymethyl (3R)-2,6-dihydroxy-3-(2-oxobutyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 158495132) has the molecular formula C19H25BO8 and a molecular weight of 392.21 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl (3R)-2,6-dihydroxy-3-(2-oxobutyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl (3R)-2,6-dihydroxy-3-(2-oxobutyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 158495132 |
| Molecular Formula | C19H25BO8 |
| Molecular Weight | 392.21 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl (3R)-2,6-dihydroxy-3-(2-oxobutyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CCC(=O)C[C@H]1Cc2cc(O)cc(C(=O)OCOC(=O)C(C)(C)C)c2OB1O |
| InChI | InChI=1S/C19H25BO8/c1-5-13(21)8-12-6-11-7-14(22)9-15(16(11)28-20(12)25)17(23)26-10-27-18(24)19(2,3)4/h7,9,12,22,25H,5-6,8,10H2,1-4H3/t12-/m1/s1 |
| InChIKey | IVXHUNGGHUFCFM-GFCCVEGCSA-N |
| XLogP | 2.25 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.21 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|