C18H24BNO8 — CID 148526172
2,2-dimethylpropanoyloxymethyl 2,6-dihydroxy-3-(propanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 148526172) has the molecular formula C18H24BNO8 and a molecular weight of 393.20 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl 2,6-dihydroxy-3-(propanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl 2,6-dihydroxy-3-(propanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 148526172 |
| Molecular Formula | C18H24BNO8 |
| Molecular Weight | 393.20 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl 2,6-dihydroxy-3-(propanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CCC(=O)NC1Cc2cc(O)cc(C(=O)OCOC(=O)C(C)(C)C)c2OB1O |
| InChI | InChI=1S/C18H24BNO8/c1-5-14(22)20-13-7-10-6-11(21)8-12(15(10)28-19(13)25)16(23)26-9-27-17(24)18(2,3)4/h6,8,13,21,25H,5,7,9H2,1-4H3,(H,20,22) |
| InChIKey | MPJNAQVFYGCEKA-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.20 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|