C13H16BNO6 — CID 144978163
ethyl 3-acetamido-2,6-dihydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 144978163) has the molecular formula C13H16BNO6 and a molecular weight of 293.08 g/mol. Its IUPAC name is ethyl 3-acetamido-2,6-dihydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | ethyl 3-acetamido-2,6-dihydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 144978163 |
| Molecular Formula | C13H16BNO6 |
| Molecular Weight | 293.08 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | ethyl 3-acetamido-2,6-dihydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CCOC(=O)c1cc(O)cc2c1OB(O)C(NC(C)=O)C2 |
| InChI | InChI=1S/C13H16BNO6/c1-3-20-13(18)10-6-9(17)4-8-5-11(15-7(2)16)14(19)21-12(8)10/h4,6,11,17,19H,3,5H2,1-2H3,(H,15,16) |
| InChIKey | VYBRJJVVGCYHQN-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.08 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|