C13H14BCl2NO5 — CID 144978113
ethyl 3-acetamido-5,6-dichloro-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 144978113) has the molecular formula C13H14BCl2NO5 and a molecular weight of 345.98 g/mol. Its IUPAC name is ethyl 3-acetamido-5,6-dichloro-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | ethyl 3-acetamido-5,6-dichloro-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 144978113 |
| Molecular Formula | C13H14BCl2NO5 |
| Molecular Weight | 345.98 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | ethyl 3-acetamido-5,6-dichloro-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CCOC(=O)c1cc(Cl)c(Cl)c2c1OB(O)C(NC(C)=O)C2 |
| InChI | InChI=1S/C13H14BCl2NO5/c1-3-21-13(19)8-4-9(15)11(16)7-5-10(17-6(2)18)14(20)22-12(7)8/h4,10,20H,3,5H2,1-2H3,(H,17,18) |
| InChIKey | UOUKSBXVYPPDEP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.98 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|