C14H15BF2O5 — CID 148858817
ethyl (3R)-5,6-difluoro-2-hydroxy-3-(2-oxopropyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 148858817) has the molecular formula C14H15BF2O5 and a molecular weight of 312.08 g/mol. Its IUPAC name is ethyl (3R)-5,6-difluoro-2-hydroxy-3-(2-oxopropyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | ethyl (3R)-5,6-difluoro-2-hydroxy-3-(2-oxopropyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 148858817 |
| Molecular Formula | C14H15BF2O5 |
| Molecular Weight | 312.08 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | ethyl (3R)-5,6-difluoro-2-hydroxy-3-(2-oxopropyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CCOC(=O)c1cc(F)c(F)c2c1OB(O)[C@@H](CC(C)=O)C2 |
| InChI | InChI=1S/C14H15BF2O5/c1-3-21-14(19)10-6-11(16)12(17)9-5-8(4-7(2)18)15(20)22-13(9)10/h6,8,20H,3-5H2,1-2H3/t8-/m0/s1 |
| InChIKey | OYXIZQIWFRLJOX-QMMMGPOBSA-N |
| XLogP | 1.91 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.08 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|