C16H19BCl2O5 — CID 149239881
ethyl (3R)-6,7-dichloro-2-hydroxy-3-(2-oxopentyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 149239881) has the molecular formula C16H19BCl2O5 and a molecular weight of 373.04 g/mol. Its IUPAC name is ethyl (3R)-6,7-dichloro-2-hydroxy-3-(2-oxopentyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | ethyl (3R)-6,7-dichloro-2-hydroxy-3-(2-oxopentyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 149239881 |
| Molecular Formula | C16H19BCl2O5 |
| Molecular Weight | 373.04 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | ethyl (3R)-6,7-dichloro-2-hydroxy-3-(2-oxopentyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CCCC(=O)C[C@H]1Cc2cc(Cl)c(Cl)c(C(=O)OCC)c2OB1O |
| InChI | InChI=1S/C16H19BCl2O5/c1-3-5-11(20)8-10-6-9-7-12(18)14(19)13(16(21)23-4-2)15(9)24-17(10)22/h7,10,22H,3-6,8H2,1-2H3/t10-/m1/s1 |
| InChIKey | XLYXJJGEZGGOSL-SNVBAGLBSA-N |
| XLogP | 3.71 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.04 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|