C19H25BClNO7 — CID 144978413
2,2-dimethylpropanoyloxymethyl (3R)-3-(butanoylamino)-6-chloro-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 144978413) has the molecular formula C19H25BClNO7 and a molecular weight of 425.67 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl (3R)-3-(butanoylamino)-6-chloro-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl (3R)-3-(butanoylamino)-6-chloro-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 144978413 |
| Molecular Formula | C19H25BClNO7 |
| Molecular Weight | 425.67 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl (3R)-3-(butanoylamino)-6-chloro-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CCCC(=O)N[C@H]1Cc2cc(Cl)cc(C(=O)OCOC(=O)C(C)(C)C)c2OB1O |
| InChI | InChI=1S/C19H25BClNO7/c1-5-6-15(23)22-14-8-11-7-12(21)9-13(16(11)29-20(14)26)17(24)27-10-28-18(25)19(2,3)4/h7,9,14,26H,5-6,8,10H2,1-4H3,(H,22,23)/t14-/m0/s1 |
| InChIKey | KBBXQFNUHPBGMY-AWEZNQCLSA-N |
| XLogP | 2.28 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.67 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|