C17H20BF2NO7 — CID 140925621
4,4-difluorobutanoyloxymethyl (3R)-2-hydroxy-3-(propanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 140925621) has the molecular formula C17H20BF2NO7 and a molecular weight of 399.16 g/mol. Its IUPAC name is 4,4-difluorobutanoyloxymethyl (3R)-2-hydroxy-3-(propanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | 4,4-difluorobutanoyloxymethyl (3R)-2-hydroxy-3-(propanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 140925621 |
| Molecular Formula | C17H20BF2NO7 |
| Molecular Weight | 399.16 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 4,4-difluorobutanoyloxymethyl (3R)-2-hydroxy-3-(propanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CCC(=O)N[C@H]1Cc2cccc(C(=O)OCOC(=O)CCC(F)F)c2OB1O |
| InChI | InChI=1S/C17H20BF2NO7/c1-2-14(22)21-12-8-10-4-3-5-11(16(10)28-18(12)25)17(24)27-9-26-15(23)7-6-13(19)20/h3-5,12-13,25H,2,6-9H2,1H3,(H,21,22)/t12-/m0/s1 |
| InChIKey | HSWYPCNTNYYIBP-LBPRGKRZSA-N |
| XLogP | 1.24 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.16 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|