C21H26BF2NO8 — CID 145329346
[2-(oxan-4-yl)acetyl]oxymethyl (3R)-3-(3,3-difluorobutanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 145329346) has the molecular formula C21H26BF2NO8 and a molecular weight of 469.25 g/mol. Its IUPAC name is [2-(oxan-4-yl)acetyl]oxymethyl (3R)-3-(3,3-difluorobutanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | [2-(oxan-4-yl)acetyl]oxymethyl (3R)-3-(3,3-difluorobutanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 145329346 |
| Molecular Formula | C21H26BF2NO8 |
| Molecular Weight | 469.25 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | [2-(oxan-4-yl)acetyl]oxymethyl (3R)-3-(3,3-difluorobutanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CC(F)(F)CC(=O)N[C@H]1Cc2cccc(C(=O)OCOC(=O)CC3CCOCC3)c2OB1O |
| InChI | InChI=1S/C21H26BF2NO8/c1-21(23,24)11-17(26)25-16-10-14-3-2-4-15(19(14)33-22(16)29)20(28)32-12-31-18(27)9-13-5-7-30-8-6-13/h2-4,13,16,29H,5-12H2,1H3,(H,25,26)/t16-/m0/s1 |
| InChIKey | GRRCUDUPIFDLDQ-INIZCTEOSA-N |
| XLogP | 1.65 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|