C15H20BNO6 — CID 144978263
ethyl 2-hydroxy-7-methoxy-3-(propanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 144978263) has the molecular formula C15H20BNO6 and a molecular weight of 321.14 g/mol. Its IUPAC name is ethyl 2-hydroxy-7-methoxy-3-(propanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | ethyl 2-hydroxy-7-methoxy-3-(propanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 144978263 |
| Molecular Formula | C15H20BNO6 |
| Molecular Weight | 321.14 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | ethyl 2-hydroxy-7-methoxy-3-(propanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CCOC(=O)c1c(OC)ccc2c1OB(O)C(NC(=O)CC)C2 |
| InChI | InChI=1S/C15H20BNO6/c1-4-12(18)17-11-8-9-6-7-10(21-3)13(15(19)22-5-2)14(9)23-16(11)20/h6-7,11,20H,4-5,8H2,1-3H3,(H,17,18) |
| InChIKey | PUQPGBSMFREQGB-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.14 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|