C14H19BClNO5 — CID 153063691
N-[(3R)-7-chloro-8-[ethoxy(hydroxy)methyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]propanamide (PubChem CID 153063691) has the molecular formula C14H19BClNO5 and a molecular weight of 327.57 g/mol. Its IUPAC name is N-[(3R)-7-chloro-8-[ethoxy(hydroxy)methyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]propanamide.
| Compound Name | N-[(3R)-7-chloro-8-[ethoxy(hydroxy)methyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]propanamide |
|---|---|
| PubChem CID | 153063691 |
| Molecular Formula | C14H19BClNO5 |
| Molecular Weight | 327.57 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | N-[(3R)-7-chloro-8-[ethoxy(hydroxy)methyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]propanamide |
| SMILES | CCOC(O)c1c(Cl)ccc2c1OB(O)[C@@H](NC(=O)CC)C2 |
| InChI | InChI=1S/C14H19BClNO5/c1-3-11(18)17-10-7-8-5-6-9(16)12(14(19)21-4-2)13(8)22-15(10)20/h5-6,10,14,19-20H,3-4,7H2,1-2H3,(H,17,18)/t10-,14?/m0/s1 |
| InChIKey | VJYLHIQOOGYDFH-XLLULAGJSA-N |
| XLogP | 1.22 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.57 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|