C19H24BN3O5 — CID 144668279
2-[3,5-bis(aminomethyl)phenyl]-N-[(3R)-8-(dihydroxymethyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]acetamide (PubChem CID 144668279) has the molecular formula C19H24BN3O5 and a molecular weight of 385.23 g/mol. Its IUPAC name is 2-[3,5-bis(aminomethyl)phenyl]-N-[(3R)-8-(dihydroxymethyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]acetamide.
| Compound Name | 2-[3,5-bis(aminomethyl)phenyl]-N-[(3R)-8-(dihydroxymethyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]acetamide |
|---|---|
| PubChem CID | 144668279 |
| Molecular Formula | C19H24BN3O5 |
| Molecular Weight | 385.23 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 2-[3,5-bis(aminomethyl)phenyl]-N-[(3R)-8-(dihydroxymethyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]acetamide |
| SMILES | NCc1cc(CN)cc(CC(=O)N[C@H]2Cc3cccc(C(O)O)c3OB2O)c1 |
| InChI | InChI=1S/C19H24BN3O5/c21-9-12-4-11(5-13(6-12)10-22)7-17(24)23-16-8-14-2-1-3-15(19(25)26)18(14)28-20(16)27/h1-6,16,19,25-27H,7-10,21-22H2,(H,23,24)/t16-/m0/s1 |
| InChIKey | SIXXGLWALUPALG-INIZCTEOSA-N |
| XLogP | -0.73 |
| TPSA | 151.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.23 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|