C18H26BNO8 — CID 163437819
2,2-dimethylpropanoyloxymethyl (3R)-2,7-dihydroxy-3-(propanoylamino)-3,4,5,6-tetrahydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 163437819) has the molecular formula C18H26BNO8 and a molecular weight of 395.22 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl (3R)-2,7-dihydroxy-3-(propanoylamino)-3,4,5,6-tetrahydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl (3R)-2,7-dihydroxy-3-(propanoylamino)-3,4,5,6-tetrahydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 163437819 |
| Molecular Formula | C18H26BNO8 |
| Molecular Weight | 395.22 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl (3R)-2,7-dihydroxy-3-(propanoylamino)-3,4,5,6-tetrahydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CCC(=O)N[C@H]1CC2=C(OB1O)C(C(=O)OCOC(=O)C(C)(C)C)=C(O)CC2 |
| InChI | InChI=1S/C18H26BNO8/c1-5-13(22)20-12-8-10-6-7-11(21)14(15(10)28-19(12)25)16(23)26-9-27-17(24)18(2,3)4/h12,21,25H,5-9H2,1-4H3,(H,20,22)/t12-/m0/s1 |
| InChIKey | AVZMERLVYBPTAO-LBPRGKRZSA-N |
| XLogP | 1.27 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.22 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|