C21H29BF3NO5 — CID 145329134
heptyl (3R)-2-hydroxy-3-(5,5,5-trifluoropentanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 145329134) has the molecular formula C21H29BF3NO5 and a molecular weight of 443.27 g/mol. Its IUPAC name is heptyl (3R)-2-hydroxy-3-(5,5,5-trifluoropentanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | heptyl (3R)-2-hydroxy-3-(5,5,5-trifluoropentanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 145329134 |
| Molecular Formula | C21H29BF3NO5 |
| Molecular Weight | 443.27 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | heptyl (3R)-2-hydroxy-3-(5,5,5-trifluoropentanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CCCCCCCOC(=O)c1cccc2c1OB(O)[C@@H](NC(=O)CCCC(F)(F)F)C2 |
| InChI | InChI=1S/C21H29BF3NO5/c1-2-3-4-5-6-13-30-20(28)16-10-7-9-15-14-17(22(29)31-19(15)16)26-18(27)11-8-12-21(23,24)25/h7,9-10,17,29H,2-6,8,11-14H2,1H3,(H,26,27)/t17-/m0/s1 |
| InChIKey | HQLOVRMWJRKCFV-KRWDZBQOSA-N |
| XLogP | 3.99 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.27 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|