C16H19BN2O5 — CID 140739781
propyl (3R)-3-(3-cyanopropanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 140739781) has the molecular formula C16H19BN2O5 and a molecular weight of 330.15 g/mol. Its IUPAC name is propyl (3R)-3-(3-cyanopropanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | propyl (3R)-3-(3-cyanopropanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 140739781 |
| Molecular Formula | C16H19BN2O5 |
| Molecular Weight | 330.15 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | propyl (3R)-3-(3-cyanopropanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CCCOC(=O)c1cccc2c1OB(O)[C@@H](NC(=O)CCC#N)C2 |
| InChI | InChI=1S/C16H19BN2O5/c1-2-9-23-16(21)12-6-3-5-11-10-13(17(22)24-15(11)12)19-14(20)7-4-8-18/h3,5-6,13,22H,2,4,7,9-10H2,1H3,(H,19,20)/t13-/m0/s1 |
| InChIKey | PIZGEEGSFSPBFB-ZDUSSCGKSA-N |
| XLogP | 1.00 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.15 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|