C20H20BF2NO5 — CID 145329130
benzyl (3R)-3-(2,2-difluorobutanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 145329130) has the molecular formula C20H20BF2NO5 and a molecular weight of 403.19 g/mol. Its IUPAC name is benzyl (3R)-3-(2,2-difluorobutanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | benzyl (3R)-3-(2,2-difluorobutanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 145329130 |
| Molecular Formula | C20H20BF2NO5 |
| Molecular Weight | 403.19 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | benzyl (3R)-3-(2,2-difluorobutanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CCC(F)(F)C(=O)N[C@H]1Cc2cccc(C(=O)OCc3ccccc3)c2OB1O |
| InChI | InChI=1S/C20H20BF2NO5/c1-2-20(22,23)19(26)24-16-11-14-9-6-10-15(17(14)29-21(16)27)18(25)28-12-13-7-4-3-5-8-13/h3-10,16,27H,2,11-12H2,1H3,(H,24,26)/t16-/m0/s1 |
| InChIKey | RCPTXNTUXXMLOJ-INIZCTEOSA-N |
| XLogP | 2.53 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.19 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|