C19H17BN2O4 — CID 161125396
N-[(3R)-8-acetyl-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]-1H-indole-4-carboxamide (PubChem CID 161125396) has the molecular formula C19H17BN2O4 and a molecular weight of 348.17 g/mol. Its IUPAC name is N-[(3R)-8-acetyl-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]-1H-indole-4-carboxamide.
| Compound Name | N-[(3R)-8-acetyl-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]-1H-indole-4-carboxamide |
|---|---|
| PubChem CID | 161125396 |
| Molecular Formula | C19H17BN2O4 |
| Molecular Weight | 348.17 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | N-[(3R)-8-acetyl-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]-1H-indole-4-carboxamide |
| SMILES | CC(=O)c1cccc2c1OB(O)[C@@H](NC(=O)c1cccc3[nH]ccc13)C2 |
| InChI | InChI=1S/C19H17BN2O4/c1-11(23)13-5-2-4-12-10-17(20(25)26-18(12)13)22-19(24)15-6-3-7-16-14(15)8-9-21-16/h2-9,17,21,25H,10H2,1H3,(H,22,24)/t17-/m0/s1 |
| InChIKey | RCNHEVFIVMKAFK-KRWDZBQOSA-N |
| XLogP | 2.12 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.17 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|